C8H21N5O — CID 57107156
2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]acetamide (PubChem CID 57107156) has the molecular formula C8H21N5O and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]acetamide.
| Compound Name | 2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]acetamide |
|---|---|
| PubChem CID | 57107156 |
| Molecular Formula | C8H21N5O |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]acetamide |
| SMILES | NCCNCCNCCNCC(N)=O |
| InChI | InChI=1S/C8H21N5O/c9-1-2-11-3-4-12-5-6-13-7-8(10)14/h11-13H,1-7,9H2,(H2,10,14) |
| InChIKey | HRHQIQZEQJEGRU-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|