C15H36N8O2 — CID 59846980
N,N'-bis[2-[2-(2-aminoethylamino)ethylamino]ethyl]propanediamide (PubChem CID 59846980) has the molecular formula C15H36N8O2 and a molecular weight of 360.51 g/mol. Its IUPAC name is N,N'-bis[2-[2-(2-aminoethylamino)ethylamino]ethyl]propanediamide.
| Compound Name | N,N'-bis[2-[2-(2-aminoethylamino)ethylamino]ethyl]propanediamide |
|---|---|
| PubChem CID | 59846980 |
| Molecular Formula | C15H36N8O2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | N,N'-bis[2-[2-(2-aminoethylamino)ethylamino]ethyl]propanediamide |
| SMILES | NCCNCCNCCNC(=O)CC(=O)NCCNCCNCCN |
| InChI | InChI=1S/C15H36N8O2/c16-1-3-18-5-7-20-9-11-22-14(24)13-15(25)23-12-10-21-8-6-19-4-2-17/h18-21H,1-13,16-17H2,(H,22,24)(H,23,25) |
| InChIKey | XWJUBVOJMADFIS-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|