C11H26N6O2 — CID 100925313
N,N'-bis[2-(2-aminoethylamino)ethyl]propanediamide (PubChem CID 100925313) has the molecular formula C11H26N6O2 and a molecular weight of 274.37 g/mol. Its IUPAC name is N,N'-bis[2-(2-aminoethylamino)ethyl]propanediamide.
| Compound Name | N,N'-bis[2-(2-aminoethylamino)ethyl]propanediamide |
|---|---|
| PubChem CID | 100925313 |
| Molecular Formula | C11H26N6O2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | N,N'-bis[2-(2-aminoethylamino)ethyl]propanediamide |
| SMILES | NCCNCCNC(=O)CC(=O)NCCNCCN |
| InChI | InChI=1S/C11H26N6O2/c12-1-3-14-5-7-16-10(18)9-11(19)17-8-6-15-4-2-13/h14-15H,1-9,12-13H2,(H,16,18)(H,17,19) |
| InChIKey | MFLRVWBYHUFTRG-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|