About 2-(propylamino)acetamide
2-(propylamino)acetamide (PubChem CID 15839438) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is 2-(propylamino)acetamide.
Molecular Properties
| Compound Name | 2-(propylamino)acetamide |
| PubChem CID | 15839438 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | 2-(propylamino)acetamide |
| SMILES | CCCNCC(N)=O |
| InChI | InChI=1S/C5H12N2O/c1-2-3-7-4-5(6)8/h7H,2-4H2,1H3,(H2,6,8) |
| InChIKey | LKZRYXDGZQOPNA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(propylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propylamino)acetamide?
The IUPAC name of 2-(propylamino)acetamide (CID 15839438) is 2-(propylamino)acetamide.
What is the SMILES notation for 2-(propylamino)acetamide?
The canonical SMILES for 2-(propylamino)acetamide is CCCNCC(N)=O.
What is the InChIKey of 2-(propylamino)acetamide?
The InChIKey is LKZRYXDGZQOPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-2-3-7-4-5(6)8/h7H,2-4H2,1H3,(H2,6,8).
What are the key properties of 2-(propylamino)acetamide?
2-(propylamino)acetamide has a molecular weight of 116.16 g/mol, XLogP of -0.53, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propylamino)acetamide is sourced from PubChem (CID 15839438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).