C19H36N4O10 — CID 89221627
(2R,3S,4R,5S)-6-[[(5S)-5-amino-6-[(6-amino-1-methoxy-1-oxohexan-2-yl)amino]-6-oxohexyl]amino]-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 89221627) has the molecular formula C19H36N4O10 and a molecular weight of 480.52 g/mol. Its IUPAC name is (2R,3S,4R,5S)-6-[[(5S)-5-amino-6-[(6-amino-1-methoxy-1-oxohexan-2-yl)amino]-6-oxohexyl]amino]-2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | (2R,3S,4R,5S)-6-[[(5S)-5-amino-6-[(6-amino-1-methoxy-1-oxohexan-2-yl)amino]-6-oxohexyl]amino]-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 89221627 |
| Molecular Formula | C19H36N4O10 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | (2R,3S,4R,5S)-6-[[(5S)-5-amino-6-[(6-amino-1-methoxy-1-oxohexan-2-yl)amino]-6-oxohexyl]amino]-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | COC(=O)C(CCCCN)NC(=O)[C@@H](N)CCCCNC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C19H36N4O10/c1-33-19(32)11(7-2-4-8-20)23-16(28)10(21)6-3-5-9-22-17(29)14(26)12(24)13(25)15(27)18(30)31/h10-15,24-27H,2-9,20-21H2,1H3,(H,22,29)(H,23,28)(H,30,31)/t10-,11?,12+,13-,14-,15+/m0/s1 |
| InChIKey | IXIWSDQNJKWAIH-AWUJCIBFSA-N |
| XLogP | -4.08 |
| TPSA | 254.76 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|