C13H25N3O5 — CID 89117111
dimethyl 2-[[(2S)-2,6-diaminohexanoyl]amino]pentanedioate (PubChem CID 89117111) has the molecular formula C13H25N3O5 and a molecular weight of 303.36 g/mol. Its IUPAC name is dimethyl 2-[[(2S)-2,6-diaminohexanoyl]amino]pentanedioate.
| Compound Name | dimethyl 2-[[(2S)-2,6-diaminohexanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 89117111 |
| Molecular Formula | C13H25N3O5 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | dimethyl 2-[[(2S)-2,6-diaminohexanoyl]amino]pentanedioate |
| SMILES | COC(=O)CCC(NC(=O)[C@@H](N)CCCCN)C(=O)OC |
| InChI | InChI=1S/C13H25N3O5/c1-20-11(17)7-6-10(13(19)21-2)16-12(18)9(15)5-3-4-8-14/h9-10H,3-8,14-15H2,1-2H3,(H,16,18)/t9-,10?/m0/s1 |
| InChIKey | SONSRWSWQSKTOT-RGURZIINSA-N |
| XLogP | -0.95 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|