C17H24N2O6 — CID 25188721
dimethyl (2S)-2-[[(2S)-2-amino-3-(4-methoxyphenyl)propanoyl]amino]pentanedioate (PubChem CID 25188721) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is dimethyl (2S)-2-[[(2S)-2-amino-3-(4-methoxyphenyl)propanoyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[(2S)-2-amino-3-(4-methoxyphenyl)propanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 25188721 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | dimethyl (2S)-2-[[(2S)-2-amino-3-(4-methoxyphenyl)propanoyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)[C@@H](N)Cc1ccc(OC)cc1)C(=O)OC |
| InChI | InChI=1S/C17H24N2O6/c1-23-12-6-4-11(5-7-12)10-13(18)16(21)19-14(17(22)25-3)8-9-15(20)24-2/h4-7,13-14H,8-10,18H2,1-3H3,(H,19,21)/t13-,14-/m0/s1 |
| InChIKey | PKVMOLSQFPHMRO-KBPBESRZSA-N |
| XLogP | 0.18 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |