C11H15NO4 — CID 10955237
methyl (2S)-2-(hydroxyamino)-3-(4-methoxyphenyl)propanoate (PubChem CID 10955237) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is methyl (2S)-2-(hydroxyamino)-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-(hydroxyamino)-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 10955237 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methyl (2S)-2-(hydroxyamino)-3-(4-methoxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OC)cc1)NO |
| InChI | InChI=1S/C11H15NO4/c1-15-9-5-3-8(4-6-9)7-10(12-14)11(13)16-2/h3-6,10,12,14H,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | LDUQRKAYWUZTLE-JTQLQIEISA-N |
| XLogP | 0.76 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|