C15H19NO3 — CID 24938361
methyl (2R)-2-(but-3-ynylamino)-3-(4-methoxyphenyl)propanoate (PubChem CID 24938361) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl (2R)-2-(but-3-ynylamino)-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl (2R)-2-(but-3-ynylamino)-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 24938361 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | methyl (2R)-2-(but-3-ynylamino)-3-(4-methoxyphenyl)propanoate |
| SMILES | C#CCCN[C@H](Cc1ccc(OC)cc1)C(=O)OC |
| InChI | InChI=1S/C15H19NO3/c1-4-5-10-16-14(15(17)19-3)11-12-6-8-13(18-2)9-7-12/h1,6-9,14,16H,5,10-11H2,2-3H3/t14-/m1/s1 |
| InChIKey | NMMQYXPJZZFYBF-CQSZACIVSA-N |
| XLogP | 1.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|