C18H21NO4 — CID 140972892
methyl (2S)-2-(ethylamino)-3-[4-(4-hydroxyphenoxy)phenyl]propanoate (PubChem CID 140972892) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl (2S)-2-(ethylamino)-3-[4-(4-hydroxyphenoxy)phenyl]propanoate.
| Compound Name | methyl (2S)-2-(ethylamino)-3-[4-(4-hydroxyphenoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 140972892 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | methyl (2S)-2-(ethylamino)-3-[4-(4-hydroxyphenoxy)phenyl]propanoate |
| SMILES | CCN[C@@H](Cc1ccc(Oc2ccc(O)cc2)cc1)C(=O)OC |
| InChI | InChI=1S/C18H21NO4/c1-3-19-17(18(21)22-2)12-13-4-8-15(9-5-13)23-16-10-6-14(20)7-11-16/h4-11,17,19-20H,3,12H2,1-2H3/t17-/m0/s1 |
| InChIKey | BROWMYWTAZCIQK-KRWDZBQOSA-N |
| XLogP | 2.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |