C16H25NO2 — CID 71154738
2-(ethylamino)-1-(4-methoxyphenyl)-4,4-dimethylpentan-3-one (PubChem CID 71154738) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-(ethylamino)-1-(4-methoxyphenyl)-4,4-dimethylpentan-3-one.
| Compound Name | 2-(ethylamino)-1-(4-methoxyphenyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 71154738 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-(ethylamino)-1-(4-methoxyphenyl)-4,4-dimethylpentan-3-one |
| SMILES | CCNC(Cc1ccc(OC)cc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H25NO2/c1-6-17-14(15(18)16(2,3)4)11-12-7-9-13(19-5)10-8-12/h7-10,14,17H,6,11H2,1-5H3 |
| InChIKey | HTUPRFFOMNAHFX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |