C21H27NO4 — CID 178183360
tert-butyl (2S)-3-(4-hydroxyphenyl)-2-[(4-methoxyphenyl)methylamino]propanoate (PubChem CID 178183360) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl (2S)-3-(4-hydroxyphenyl)-2-[(4-methoxyphenyl)methylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-(4-hydroxyphenyl)-2-[(4-methoxyphenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 178183360 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl (2S)-3-(4-hydroxyphenyl)-2-[(4-methoxyphenyl)methylamino]propanoate |
| SMILES | COc1ccc(CN[C@@H](Cc2ccc(O)cc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H27NO4/c1-21(2,3)26-20(24)19(13-15-5-9-17(23)10-6-15)22-14-16-7-11-18(25-4)12-8-16/h5-12,19,22-23H,13-14H2,1-4H3/t19-/m0/s1 |
| InChIKey | UQTLRIKKFLPRPN-IBGZPJMESA-N |
| XLogP | 3.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |