C23H20F19NO3 — CID 11527754
tert-butyl (2S)-3-(4-hydroxyphenyl)-2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecylamino)propanoate (PubChem CID 11527754) has the molecular formula C23H20F19NO3 and a molecular weight of 719.38 g/mol. Its IUPAC name is tert-butyl (2S)-3-(4-hydroxyphenyl)-2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecylamino)propanoate.
| Compound Name | tert-butyl (2S)-3-(4-hydroxyphenyl)-2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecylamino)propanoate |
|---|---|
| PubChem CID | 11527754 |
| Molecular Formula | C23H20F19NO3 |
| Molecular Weight | 719.38 g/mol |
| Exact Mass | 719.11 |
| IUPAC Name | tert-butyl (2S)-3-(4-hydroxyphenyl)-2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc(O)cc1)NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H20F19NO3/c1-14(2,3)46-13(45)12(8-10-4-6-11(44)7-5-10)43-9-15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)22(38,39)23(40,41)42/h4-7,12,43-44H,8-9H2,1-3H3/t12-/m0/s1 |
| InChIKey | SGUPUKAOWJQHRP-LBPRGKRZSA-N |
| XLogP | 7.88 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.38 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|