C49H73N3O13 — CID 158052299
tert-butyl 2-amino-3-(4-hydroxyphenyl)propanoate;bis(tert-butyl 3-(4-ethoxycarbonyloxyphenyl)-2-(ethylamino)propanoate) (PubChem CID 158052299) has the molecular formula C49H73N3O13 and a molecular weight of 912.13 g/mol. Its IUPAC name is tert-butyl 2-amino-3-(4-hydroxyphenyl)propanoate;bis(tert-butyl 3-(4-ethoxycarbonyloxyphenyl)-2-(ethylamino)propanoate).
| Compound Name | tert-butyl 2-amino-3-(4-hydroxyphenyl)propanoate;bis(tert-butyl 3-(4-ethoxycarbonyloxyphenyl)-2-(ethylamino)propanoate) |
|---|---|
| PubChem CID | 158052299 |
| Molecular Formula | C49H73N3O13 |
| Molecular Weight | 912.13 g/mol |
| Exact Mass | 911.51 |
| IUPAC Name | tert-butyl 2-amino-3-(4-hydroxyphenyl)propanoate;bis(tert-butyl 3-(4-ethoxycarbonyloxyphenyl)-2-(ethylamino)propanoate) |
| SMILES | CC(C)(C)OC(=O)C(N)Cc1ccc(O)cc1.CCNC(Cc1ccc(OC(=O)OCC)cc1)C(=O)OC(C)(C)C.CCNC(Cc1ccc(OC(=O)OCC)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/2C18H27NO5.C13H19NO3/c2*1-6-19-15(16(20)24-18(3,4)5)12-13-8-10-14(11-9-13)23-17(21)22-7-2;1-13(2,3)17-12(16)11(14)8-9-4-6-10(15)7-5-9/h2*8-11,15,19H,6-7,12H2,1-5H3;4-7,11,15H,8,14H2,1-3H3 |
| InChIKey | FJPXMPJOZRNINI-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 220.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.13 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|