C14H20FNO3 — CID 71164693
tert-butyl (2R)-2-amino-3-[4-(fluoromethoxy)phenyl]propanoate (PubChem CID 71164693) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is tert-butyl (2R)-2-amino-3-[4-(fluoromethoxy)phenyl]propanoate.
| Compound Name | tert-butyl (2R)-2-amino-3-[4-(fluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 71164693 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | tert-butyl (2R)-2-amino-3-[4-(fluoromethoxy)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](N)Cc1ccc(OCF)cc1 |
| InChI | InChI=1S/C14H20FNO3/c1-14(2,3)19-13(17)12(16)8-10-4-6-11(7-5-10)18-9-15/h4-7,12H,8-9,16H2,1-3H3/t12-/m1/s1 |
| InChIKey | DBPOHOOLWKEUPX-GFCCVEGCSA-N |
| XLogP | 2.20 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |