C21H24N2O3 — CID 70059435
tert-butyl 2-amino-3-[4-[(4-cyanophenyl)methoxy]phenyl]propanoate (PubChem CID 70059435) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is tert-butyl 2-amino-3-[4-[(4-cyanophenyl)methoxy]phenyl]propanoate.
| Compound Name | tert-butyl 2-amino-3-[4-[(4-cyanophenyl)methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 70059435 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | tert-butyl 2-amino-3-[4-[(4-cyanophenyl)methoxy]phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)C(N)Cc1ccc(OCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O3/c1-21(2,3)26-20(24)19(23)12-15-8-10-18(11-9-15)25-14-17-6-4-16(13-22)5-7-17/h4-11,19H,12,14,23H2,1-3H3 |
| InChIKey | IVLVXKAFQWVDBY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |