C18H27N3O6 — CID 53355171
methyl (2S)-2-[[(1S)-1-(ethoxycarbonylamino)-2-methylpropyl]carbamoylamino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 53355171) has the molecular formula C18H27N3O6 and a molecular weight of 381.43 g/mol. Its IUPAC name is methyl (2S)-2-[[(1S)-1-(ethoxycarbonylamino)-2-methylpropyl]carbamoylamino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(1S)-1-(ethoxycarbonylamino)-2-methylpropyl]carbamoylamino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 53355171 |
| Molecular Formula | C18H27N3O6 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | methyl (2S)-2-[[(1S)-1-(ethoxycarbonylamino)-2-methylpropyl]carbamoylamino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)N[C@H](NC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)OC)C(C)C |
| InChI | InChI=1S/C18H27N3O6/c1-5-27-18(25)21-15(11(2)3)20-17(24)19-14(16(23)26-4)10-12-6-8-13(22)9-7-12/h6-9,11,14-15,22H,5,10H2,1-4H3,(H,21,25)(H2,19,20,24)/t14-,15-/m0/s1 |
| InChIKey | MQGCPCHRZYNPQU-GJZGRUSLSA-N |
| XLogP | 1.50 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|