C15H14INO4 — CID 22833547
(2S)-3-[4-(4-hydroxyphenoxy)phenyl]-2-(iodoamino)propanoic acid (PubChem CID 22833547) has the molecular formula C15H14INO4 and a molecular weight of 399.18 g/mol. Its IUPAC name is (2S)-3-[4-(4-hydroxyphenoxy)phenyl]-2-(iodoamino)propanoic acid.
| Compound Name | (2S)-3-[4-(4-hydroxyphenoxy)phenyl]-2-(iodoamino)propanoic acid |
|---|---|
| PubChem CID | 22833547 |
| Molecular Formula | C15H14INO4 |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | (2S)-3-[4-(4-hydroxyphenoxy)phenyl]-2-(iodoamino)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(Oc2ccc(O)cc2)cc1)NI |
| InChI | InChI=1S/C15H14INO4/c16-17-14(15(19)20)9-10-1-5-12(6-2-10)21-13-7-3-11(18)4-8-13/h1-8,14,17-18H,9H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | VSWSDTLXDWESGZ-AWEZNQCLSA-N |
| XLogP | 3.12 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|