C13H13IN2O5 — CID 22827339
(2,5-dioxopyrrolidin-1-yl) (2S)-3-(4-hydroxyphenyl)-2-(iodoamino)propanoate (PubChem CID 22827339) has the molecular formula C13H13IN2O5 and a molecular weight of 404.16 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-3-(4-hydroxyphenyl)-2-(iodoamino)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-3-(4-hydroxyphenyl)-2-(iodoamino)propanoate |
|---|---|
| PubChem CID | 22827339 |
| Molecular Formula | C13H13IN2O5 |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-3-(4-hydroxyphenyl)-2-(iodoamino)propanoate |
| SMILES | O=C(ON1C(=O)CCC1=O)[C@H](Cc1ccc(O)cc1)NI |
| InChI | InChI=1S/C13H13IN2O5/c14-15-10(7-8-1-3-9(17)4-2-8)13(20)21-16-11(18)5-6-12(16)19/h1-4,10,15,17H,5-7H2/t10-/m0/s1 |
| InChIKey | PAQGZZXMSKAUIJ-JTQLQIEISA-N |
| XLogP | 0.85 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|