C16H21NO6 — CID 143259221
(2,5-dioxopyrrolidin-1-yl) 3-(4-hydroxyphenoxy)-2-methylpropanoate;ethane (PubChem CID 143259221) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(4-hydroxyphenoxy)-2-methylpropanoate;ethane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-hydroxyphenoxy)-2-methylpropanoate;ethane |
|---|---|
| PubChem CID | 143259221 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-hydroxyphenoxy)-2-methylpropanoate;ethane |
| SMILES | CC.CC(COc1ccc(O)cc1)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H15NO6.C2H6/c1-9(8-20-11-4-2-10(16)3-5-11)14(19)21-15-12(17)6-7-13(15)18;1-2/h2-5,9,16H,6-8H2,1H3;1-2H3 |
| InChIKey | UVGHCXXUONTSEF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|