C15H17NO6 — CID 143085911
(2,5-dioxopyrrolidin-1-yl) 2-(4-formylphenoxy)acetate;ethane (PubChem CID 143085911) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(4-formylphenoxy)acetate;ethane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(4-formylphenoxy)acetate;ethane |
|---|---|
| PubChem CID | 143085911 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(4-formylphenoxy)acetate;ethane |
| SMILES | CC.O=Cc1ccc(OCC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C13H11NO6.C2H6/c15-7-9-1-3-10(4-2-9)19-8-13(18)20-14-11(16)5-6-12(14)17;1-2/h1-4,7H,5-6,8H2;1-2H3 |
| InChIKey | WNEIMSHJTDHGBB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|