C9H13NO6 — CID 159218851
(2,5-dioxopyrrolidin-1-yl) 2-(ethoxymethoxy)acetate (PubChem CID 159218851) has the molecular formula C9H13NO6 and a molecular weight of 231.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(ethoxymethoxy)acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(ethoxymethoxy)acetate |
|---|---|
| PubChem CID | 159218851 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(ethoxymethoxy)acetate |
| SMILES | CCOCOCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H13NO6/c1-2-14-6-15-5-9(13)16-10-7(11)3-4-8(10)12/h2-6H2,1H3 |
| InChIKey | CCTREKNHDYTZCU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|