C10H17NO5 — CID 158347666
(2,5-dioxopyrrolidin-1-yl) 3-ethoxypropanoate;methane (PubChem CID 158347666) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-ethoxypropanoate;methane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-ethoxypropanoate;methane |
|---|---|
| PubChem CID | 158347666 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-ethoxypropanoate;methane |
| SMILES | C.CCOCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H13NO5.CH4/c1-2-14-6-5-9(13)15-10-7(11)3-4-8(10)12;/h2-6H2,1H3;1H4 |
| InChIKey | GRXWFHHYDNHCCD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|