C15H23NO8 — CID 58559852
4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-(3-ethoxypropoxy)ethyl] butanedioate (PubChem CID 58559852) has the molecular formula C15H23NO8 and a molecular weight of 345.35 g/mol. Its IUPAC name is 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-(3-ethoxypropoxy)ethyl] butanedioate.
| Compound Name | 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-(3-ethoxypropoxy)ethyl] butanedioate |
|---|---|
| PubChem CID | 58559852 |
| Molecular Formula | C15H23NO8 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[2-(3-ethoxypropoxy)ethyl] butanedioate |
| SMILES | CCOCCCOCCOC(=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C15H23NO8/c1-2-21-8-3-9-22-10-11-23-14(19)6-7-15(20)24-16-12(17)4-5-13(16)18/h2-11H2,1H3 |
| InChIKey | AZCBCNKFQUVIEB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|