C23H29NO13 — CID 161141248
5-O-(2,5-dioxocyclopentyl) 1-O-[2-[2-[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]oxyethoxy]ethyl] pentanedioate (PubChem CID 161141248) has the molecular formula C23H29NO13 and a molecular weight of 527.48 g/mol. Its IUPAC name is 5-O-(2,5-dioxocyclopentyl) 1-O-[2-[2-[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]oxyethoxy]ethyl] pentanedioate.
| Compound Name | 5-O-(2,5-dioxocyclopentyl) 1-O-[2-[2-[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]oxyethoxy]ethyl] pentanedioate |
|---|---|
| PubChem CID | 161141248 |
| Molecular Formula | C23H29NO13 |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 5-O-(2,5-dioxocyclopentyl) 1-O-[2-[2-[5-(2,5-dioxopyrrolidin-1-yl)oxy-5-oxopentanoyl]oxyethoxy]ethyl] pentanedioate |
| SMILES | O=C(CCCC(=O)OC1C(=O)CCC1=O)OCCOCCOC(=O)CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C23H29NO13/c25-15-7-8-16(26)23(15)36-21(31)5-1-3-19(29)34-13-11-33-12-14-35-20(30)4-2-6-22(32)37-24-17(27)9-10-18(24)28/h23H,1-14H2 |
| InChIKey | KDBWBFWDCKJKQG-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 185.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|