C12H17NO7 — CID 162050928
tert-butyl 2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]acetate (PubChem CID 162050928) has the molecular formula C12H17NO7 and a molecular weight of 287.27 g/mol. Its IUPAC name is tert-butyl 2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]acetate.
| Compound Name | tert-butyl 2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 162050928 |
| Molecular Formula | C12H17NO7 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | tert-butyl 2-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H17NO7/c1-12(2,3)19-10(16)6-18-7-11(17)20-13-8(14)4-5-9(13)15/h4-7H2,1-3H3 |
| InChIKey | BRGDYAQVEMHUDK-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|