C11H19N3O6 — CID 143366500
tert-butyl carbamate;(2,5-dioxopyrrolidin-1-yl) 2-aminoacetate (PubChem CID 143366500) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is tert-butyl carbamate;(2,5-dioxopyrrolidin-1-yl) 2-aminoacetate.
| Compound Name | tert-butyl carbamate;(2,5-dioxopyrrolidin-1-yl) 2-aminoacetate |
|---|---|
| PubChem CID | 143366500 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | tert-butyl carbamate;(2,5-dioxopyrrolidin-1-yl) 2-aminoacetate |
| SMILES | CC(C)(C)OC(N)=O.NCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C6H8N2O4.C5H11NO2/c7-3-6(11)12-8-4(9)1-2-5(8)10;1-5(2,3)8-4(6)7/h1-3,7H2;1-3H3,(H2,6,7) |
| InChIKey | MSLDQXWKDNMKPA-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 142.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|