C11H16N2O5Y+ — CID 20683205
azanide;(2,5-dioxopyrrolidin-1-yl) 2,4-dimethyl-5-oxopentanoate;yttrium(3+) (PubChem CID 20683205) has the molecular formula C11H16N2O5Y+ and a molecular weight of 345.16 g/mol. Its IUPAC name is azanide;(2,5-dioxopyrrolidin-1-yl) 2,4-dimethyl-5-oxopentanoate;yttrium(3+).
| Compound Name | azanide;(2,5-dioxopyrrolidin-1-yl) 2,4-dimethyl-5-oxopentanoate;yttrium(3+) |
|---|---|
| PubChem CID | 20683205 |
| Molecular Formula | C11H16N2O5Y+ |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | azanide;(2,5-dioxopyrrolidin-1-yl) 2,4-dimethyl-5-oxopentanoate;yttrium(3+) |
| SMILES | CC([C-]=O)CC(C)C(=O)ON1C(=O)CCC1=O.[NH2-].[Y+3] |
| InChI | InChI=1S/C11H14NO5.H2N.Y/c1-7(6-13)5-8(2)11(16)17-12-9(14)3-4-10(12)15;;/h7-8H,3-5H2,1-2H3;1H2;/q2*-1;+3 |
| InChIKey | OJEKAZKYUPTHNB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 114.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|