C14H15N3O9 — CID 147117897
bis(2,5-dioxopyrrolidin-1-yl) 2-acetamidobutanedioate (PubChem CID 147117897) has the molecular formula C14H15N3O9 and a molecular weight of 369.29 g/mol. Its IUPAC name is bis(2,5-dioxopyrrolidin-1-yl) 2-acetamidobutanedioate.
| Compound Name | bis(2,5-dioxopyrrolidin-1-yl) 2-acetamidobutanedioate |
|---|---|
| PubChem CID | 147117897 |
| Molecular Formula | C14H15N3O9 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | bis(2,5-dioxopyrrolidin-1-yl) 2-acetamidobutanedioate |
| SMILES | CC(=O)NC(CC(=O)ON1C(=O)CCC1=O)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H15N3O9/c1-7(18)15-8(14(24)26-17-11(21)4-5-12(17)22)6-13(23)25-16-9(19)2-3-10(16)20/h8H,2-6H2,1H3,(H,15,18) |
| InChIKey | BNUABSALGRJALS-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|