C9H14N2O6 — CID 163583382
(2,5-dioxopyrrolidin-1-yl) 4,4-dihydroxy-3-(methylamino)butanoate (PubChem CID 163583382) has the molecular formula C9H14N2O6 and a molecular weight of 246.22 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4,4-dihydroxy-3-(methylamino)butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4,4-dihydroxy-3-(methylamino)butanoate |
|---|---|
| PubChem CID | 163583382 |
| Molecular Formula | C9H14N2O6 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4,4-dihydroxy-3-(methylamino)butanoate |
| SMILES | CNC(CC(=O)ON1C(=O)CCC1=O)C(O)O |
| InChI | InChI=1S/C9H14N2O6/c1-10-5(9(15)16)4-8(14)17-11-6(12)2-3-7(11)13/h5,9-10,15-16H,2-4H2,1H3 |
| InChIKey | GJLKGQVSYBQNRV-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|