C9H11NO5S — CID 87561676
(2,5-dioxopyrrolidin-1-yl) 4-oxo-3-sulfanylpentanoate (PubChem CID 87561676) has the molecular formula C9H11NO5S and a molecular weight of 245.26 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-oxo-3-sulfanylpentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-oxo-3-sulfanylpentanoate |
|---|---|
| PubChem CID | 87561676 |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-oxo-3-sulfanylpentanoate |
| SMILES | CC(=O)C(S)CC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H11NO5S/c1-5(11)6(16)4-9(14)15-10-7(12)2-3-8(10)13/h6,16H,2-4H2,1H3 |
| InChIKey | XNXQOLOBCCNYPU-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 80.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|