C11H17NO5S — CID 144633595
(2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate;propane (PubChem CID 144633595) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate;propane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate;propane |
|---|---|
| PubChem CID | 144633595 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate;propane |
| SMILES | CC(=O)SCC(=O)ON1C(=O)CCC1=O.CCC |
| InChI | InChI=1S/C8H9NO5S.C3H8/c1-5(10)15-4-8(13)14-9-6(11)2-3-7(9)12;1-3-2/h2-4H2,1H3;3H2,1-2H3 |
| InChIKey | MXFJPTZSDYQSPA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|