C27H33N3O16S3 — CID 158621955
(2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate;(2,5-dioxopyrrolidin-1-yl) 2-(2-acetylsulfanylethoxy)acetate;(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate (PubChem CID 158621955) has the molecular formula C27H33N3O16S3 and a molecular weight of 751.77 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate;(2,5-dioxopyrrolidin-1-yl) 2-(2-acetylsulfanylethoxy)acetate;(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate;(2,5-dioxopyrrolidin-1-yl) 2-(2-acetylsulfanylethoxy)acetate;(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate |
|---|---|
| PubChem CID | 158621955 |
| Molecular Formula | C27H33N3O16S3 |
| Molecular Weight | 751.77 g/mol |
| Exact Mass | 751.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-acetylsulfanylacetate;(2,5-dioxopyrrolidin-1-yl) 2-(2-acetylsulfanylethoxy)acetate;(2,5-dioxopyrrolidin-1-yl) 3-acetylsulfanylpropanoate |
| SMILES | CC(=O)SCC(=O)ON1C(=O)CCC1=O.CC(=O)SCCC(=O)ON1C(=O)CCC1=O.CC(=O)SCCOCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H13NO6S.C9H11NO5S.C8H9NO5S/c1-7(12)18-5-4-16-6-10(15)17-11-8(13)2-3-9(11)14;1-6(11)16-5-4-9(14)15-10-7(12)2-3-8(10)13;1-5(10)15-4-8(13)14-9-6(11)2-3-7(9)12/h2-6H2,1H3;2-5H2,1H3;2-4H2,1H3 |
| InChIKey | HYCNGXKMYVLHLI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 251.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.77 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|