C19H31NO7S — CID 154935137
(2,5-dioxopyrrolidin-1-yl) 4-[2-(4-acetylsulfanyl-2-methylbutan-2-yl)oxyethoxy]-4-methylpentanoate (PubChem CID 154935137) has the molecular formula C19H31NO7S and a molecular weight of 417.52 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[2-(4-acetylsulfanyl-2-methylbutan-2-yl)oxyethoxy]-4-methylpentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-(4-acetylsulfanyl-2-methylbutan-2-yl)oxyethoxy]-4-methylpentanoate |
|---|---|
| PubChem CID | 154935137 |
| Molecular Formula | C19H31NO7S |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[2-(4-acetylsulfanyl-2-methylbutan-2-yl)oxyethoxy]-4-methylpentanoate |
| SMILES | CC(=O)SCCC(C)(C)OCCOC(C)(C)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H31NO7S/c1-14(21)28-13-10-19(4,5)26-12-11-25-18(2,3)9-8-17(24)27-20-15(22)6-7-16(20)23/h6-13H2,1-5H3 |
| InChIKey | SQUNYUQJCRUMIX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|