C16H25NO6S — CID 142096577
(2,5-dioxopyrrolidin-1-yl) 3-(3-acetylsulfanyl-3-methylbutoxy)-3-methylbutanoate (PubChem CID 142096577) has the molecular formula C16H25NO6S and a molecular weight of 359.44 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(3-acetylsulfanyl-3-methylbutoxy)-3-methylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(3-acetylsulfanyl-3-methylbutoxy)-3-methylbutanoate |
|---|---|
| PubChem CID | 142096577 |
| Molecular Formula | C16H25NO6S |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(3-acetylsulfanyl-3-methylbutoxy)-3-methylbutanoate |
| SMILES | CC(=O)SC(C)(C)CCOC(C)(C)CC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H25NO6S/c1-11(18)24-16(4,5)8-9-22-15(2,3)10-14(21)23-17-12(19)6-7-13(17)20/h6-10H2,1-5H3 |
| InChIKey | HJBARBJGYNTTEW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|