C20H34N2O7 — CID 177178039
(2,5-dioxopyrrolidin-1-yl) 3-[2-methyl-4-[2-methyl-4-(propan-2-ylideneamino)oxybutan-2-yl]oxybutan-2-yl]oxypropanoate (PubChem CID 177178039) has the molecular formula C20H34N2O7 and a molecular weight of 414.50 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-methyl-4-[2-methyl-4-(propan-2-ylideneamino)oxybutan-2-yl]oxybutan-2-yl]oxypropanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-methyl-4-[2-methyl-4-(propan-2-ylideneamino)oxybutan-2-yl]oxybutan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 177178039 |
| Molecular Formula | C20H34N2O7 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-methyl-4-[2-methyl-4-(propan-2-ylideneamino)oxybutan-2-yl]oxybutan-2-yl]oxypropanoate |
| SMILES | CC(C)=NOCCC(C)(C)OCCC(C)(C)OCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H34N2O7/c1-15(2)21-28-14-11-20(5,6)27-13-10-19(3,4)26-12-9-18(25)29-22-16(23)7-8-17(22)24/h7-14H2,1-6H3 |
| InChIKey | BRQHNKNFISOREO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 103.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|