C24H36N2O8S2 — CID 145275318
(4-aminophenyl) 2-(disulfanyl)ethyl carbonate;(2,5-dioxopyrrolidin-1-yl) 4-methyl-4-(3-methylbutoxy)pentanoate (PubChem CID 145275318) has the molecular formula C24H36N2O8S2 and a molecular weight of 544.69 g/mol. Its IUPAC name is (4-aminophenyl) 2-(disulfanyl)ethyl carbonate;(2,5-dioxopyrrolidin-1-yl) 4-methyl-4-(3-methylbutoxy)pentanoate.
| Compound Name | (4-aminophenyl) 2-(disulfanyl)ethyl carbonate;(2,5-dioxopyrrolidin-1-yl) 4-methyl-4-(3-methylbutoxy)pentanoate |
|---|---|
| PubChem CID | 145275318 |
| Molecular Formula | C24H36N2O8S2 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | (4-aminophenyl) 2-(disulfanyl)ethyl carbonate;(2,5-dioxopyrrolidin-1-yl) 4-methyl-4-(3-methylbutoxy)pentanoate |
| SMILES | CC(C)CCOC(C)(C)CCC(=O)ON1C(=O)CCC1=O.Nc1ccc(OC(=O)OCCSS)cc1 |
| InChI | InChI=1S/C15H25NO5.C9H11NO3S2/c1-11(2)8-10-20-15(3,4)9-7-14(19)21-16-12(17)5-6-13(16)18;10-7-1-3-8(4-2-7)13-9(11)12-5-6-15-14/h11H,5-10H2,1-4H3;1-4,14H,5-6,10H2 |
| InChIKey | VXVIJPGWPSZUMS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|