About (4-carboniodidoylphenyl) 3-methylbutyl carbonate
(4-carboniodidoylphenyl) 3-methylbutyl carbonate (PubChem CID 58041640) has the molecular formula C13H15IO4
and a molecular weight of 362.16 g/mol. Its IUPAC name is (4-carboniodidoylphenyl) 3-methylbutyl carbonate.
Molecular Properties
| Compound Name | (4-carboniodidoylphenyl) 3-methylbutyl carbonate |
| PubChem CID | 58041640 |
| Molecular Formula | C13H15IO4 |
| Molecular Weight | 362.16 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | (4-carboniodidoylphenyl) 3-methylbutyl carbonate |
| SMILES | CC(C)CCOC(=O)Oc1ccc(C(=O)I)cc1 |
| InChI | InChI=1S/C13H15IO4/c1-9(2)7-8-17-13(16)18-11-5-3-10(4-6-11)12(14)15/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | FGXLWUNHIIASGU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-carboniodidoylphenyl) 3-methylbutyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carboniodidoylphenyl) 3-methylbutyl carbonate?
The IUPAC name of (4-carboniodidoylphenyl) 3-methylbutyl carbonate (CID 58041640) is (4-carboniodidoylphenyl) 3-methylbutyl carbonate.
What is the SMILES notation for (4-carboniodidoylphenyl) 3-methylbutyl carbonate?
The canonical SMILES for (4-carboniodidoylphenyl) 3-methylbutyl carbonate is CC(C)CCOC(=O)Oc1ccc(C(=O)I)cc1.
What is the InChIKey of (4-carboniodidoylphenyl) 3-methylbutyl carbonate?
The InChIKey is FGXLWUNHIIASGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15IO4/c1-9(2)7-8-17-13(16)18-11-5-3-10(4-6-11)12(14)15/h3-6,9H,7-8H2,1-2H3.
What are the key properties of (4-carboniodidoylphenyl) 3-methylbutyl carbonate?
(4-carboniodidoylphenyl) 3-methylbutyl carbonate has a molecular weight of 362.16 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carboniodidoylphenyl) 3-methylbutyl carbonate is sourced from PubChem (CID 58041640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).