C17H20N2O6 — CID 129016839
(2,5-dioxopyrrolidin-1-yl) [4-(3-methylbutylcarbamoyl)phenyl] carbonate (PubChem CID 129016839) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [4-(3-methylbutylcarbamoyl)phenyl] carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [4-(3-methylbutylcarbamoyl)phenyl] carbonate |
|---|---|
| PubChem CID | 129016839 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [4-(3-methylbutylcarbamoyl)phenyl] carbonate |
| SMILES | CC(C)CCNC(=O)c1ccc(OC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C17H20N2O6/c1-11(2)9-10-18-16(22)12-3-5-13(6-4-12)24-17(23)25-19-14(20)7-8-15(19)21/h3-6,11H,7-10H2,1-2H3,(H,18,22) |
| InChIKey | GUIALBJYHYJDJF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|