C17H22N2O3 — CID 51195030
4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(3-methylbutyl)benzamide (PubChem CID 51195030) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(3-methylbutyl)benzamide.
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 51195030 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-N-(3-methylbutyl)benzamide |
| SMILES | CC(C)CCNC(=O)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C17H22N2O3/c1-12(2)9-10-18-17(22)14-5-3-13(4-6-14)11-19-15(20)7-8-16(19)21/h3-6,12H,7-11H2,1-2H3,(H,18,22) |
| InChIKey | XQHTZFNEXODERV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|