C18H26ClN3O3 — CID 119641489
N-(2-amino-2-ethylbutyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide;hydrochloride (PubChem CID 119641489) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119641489 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)c1ccc(CN2C(=O)CCC2=O)cc1.Cl |
| InChI | InChI=1S/C18H25N3O3.ClH/c1-3-18(19,4-2)12-20-17(24)14-7-5-13(6-8-14)11-21-15(22)9-10-16(21)23;/h5-8H,3-4,9-12,19H2,1-2H3,(H,20,24);1H |
| InChIKey | VCVYXHCERZPAIF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|