C19H26N2O4 — CID 27682911
N-(3-butoxypropyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 27682911) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-(3-butoxypropyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-(3-butoxypropyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 27682911 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-(3-butoxypropyl)-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | CCCCOCCCNC(=O)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-2-3-12-25-13-4-11-20-19(24)16-7-5-15(6-8-16)14-21-17(22)9-10-18(21)23/h5-8H,2-4,9-14H2,1H3,(H,20,24) |
| InChIKey | HGDQSMBVTVRDRU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|