C23H27N3O3 — CID 53135581
4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]-N-(3-methylbutyl)benzamide (PubChem CID 53135581) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]-N-(3-methylbutyl)benzamide.
| Compound Name | 4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 53135581 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]-N-(3-methylbutyl)benzamide |
| SMILES | CC(C)CCNC(=O)c1ccc(CN2CCN(c3ccccc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-17(2)12-13-24-21(27)19-10-8-18(9-11-19)16-25-14-15-26(23(29)22(25)28)20-6-4-3-5-7-20/h3-11,17H,12-16H2,1-2H3,(H,24,27) |
| InChIKey | BZUUDUDGMWSFHR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|