C25H25N3O4 — CID 53135627
4-[(4-benzyl-2,3-dioxopiperazin-1-yl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzamide (PubChem CID 53135627) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 4-[(4-benzyl-2,3-dioxopiperazin-1-yl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzamide.
| Compound Name | 4-[(4-benzyl-2,3-dioxopiperazin-1-yl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53135627 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 4-[(4-benzyl-2,3-dioxopiperazin-1-yl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc(CN3CCN(Cc4ccccc4)C(=O)C3=O)cc2)o1 |
| InChI | InChI=1S/C25H25N3O4/c1-18-7-12-22(32-18)15-26-23(29)21-10-8-20(9-11-21)17-28-14-13-27(24(30)25(28)31)16-19-5-3-2-4-6-19/h2-12H,13-17H2,1H3,(H,26,29) |
| InChIKey | RFGJSVHKKFHKKN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|