C25H23FN4O3 — CID 53135643
4-[[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]methyl]-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 53135643) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is 4-[[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]methyl]-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-[[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]methyl]-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 53135643 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 4-[[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]methyl]-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccnc1)c1ccc(CN2CCN(Cc3ccc(F)cc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C25H23FN4O3/c26-22-9-5-19(6-10-22)17-30-13-12-29(24(32)25(30)33)16-18-3-7-21(8-4-18)23(31)28-15-20-2-1-11-27-14-20/h1-11,14H,12-13,15-17H2,(H,28,31) |
| InChIKey | LQIWSDQTVZCLHZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|