C26H24FN3O3 — CID 53135615
4-[(4-benzyl-2,3-dioxopiperazin-1-yl)methyl]-N-(2-fluoro-4-methylphenyl)benzamide (PubChem CID 53135615) has the molecular formula C26H24FN3O3 and a molecular weight of 445.49 g/mol. Its IUPAC name is 4-[(4-benzyl-2,3-dioxopiperazin-1-yl)methyl]-N-(2-fluoro-4-methylphenyl)benzamide.
| Compound Name | 4-[(4-benzyl-2,3-dioxopiperazin-1-yl)methyl]-N-(2-fluoro-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 53135615 |
| Molecular Formula | C26H24FN3O3 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-[(4-benzyl-2,3-dioxopiperazin-1-yl)methyl]-N-(2-fluoro-4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCN(Cc4ccccc4)C(=O)C3=O)cc2)c(F)c1 |
| InChI | InChI=1S/C26H24FN3O3/c1-18-7-12-23(22(27)15-18)28-24(31)21-10-8-20(9-11-21)17-30-14-13-29(25(32)26(30)33)16-19-5-3-2-4-6-19/h2-12,15H,13-14,16-17H2,1H3,(H,28,31) |
| InChIKey | XYRTZBRJLIVZTJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|