C25H22FN3O3 — CID 53135578
4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]-N-(2-fluoro-4-methylphenyl)benzamide (PubChem CID 53135578) has the molecular formula C25H22FN3O3 and a molecular weight of 431.47 g/mol. Its IUPAC name is 4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]-N-(2-fluoro-4-methylphenyl)benzamide.
| Compound Name | 4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]-N-(2-fluoro-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 53135578 |
| Molecular Formula | C25H22FN3O3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]-N-(2-fluoro-4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCN(c4ccccc4)C(=O)C3=O)cc2)c(F)c1 |
| InChI | InChI=1S/C25H22FN3O3/c1-17-7-12-22(21(26)15-17)27-23(30)19-10-8-18(9-11-19)16-28-13-14-29(25(32)24(28)31)20-5-3-2-4-6-20/h2-12,15H,13-14,16H2,1H3,(H,27,30) |
| InChIKey | WHSSCZPFXUWIQO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|