C18H15FN2O3 — CID 18166253
3-(2,5-dioxopyrrolidin-1-yl)-N-(2-fluoro-4-methylphenyl)benzamide (PubChem CID 18166253) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(2-fluoro-4-methylphenyl)benzamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(2-fluoro-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 18166253 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(2-fluoro-4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(N3C(=O)CCC3=O)c2)c(F)c1 |
| InChI | InChI=1S/C18H15FN2O3/c1-11-5-6-15(14(19)9-11)20-18(24)12-3-2-4-13(10-12)21-16(22)7-8-17(21)23/h2-6,9-10H,7-8H2,1H3,(H,20,24) |
| InChIKey | OTHTVCAJWVRIPM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|