C21H18N2O7 — CID 55341762
dimethyl 2-[[3-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]benzene-1,4-dicarboxylate (PubChem CID 55341762) has the molecular formula C21H18N2O7 and a molecular weight of 410.38 g/mol. Its IUPAC name is dimethyl 2-[[3-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[3-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 55341762 |
| Molecular Formula | C21H18N2O7 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | dimethyl 2-[[3-(2,5-dioxopyrrolidin-1-yl)benzoyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)c2cccc(N3C(=O)CCC3=O)c2)c1 |
| InChI | InChI=1S/C21H18N2O7/c1-29-20(27)13-6-7-15(21(28)30-2)16(11-13)22-19(26)12-4-3-5-14(10-12)23-17(24)8-9-18(23)25/h3-7,10-11H,8-9H2,1-2H3,(H,22,26) |
| InChIKey | ZONPVRIXPLYINM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|