C25H27N3O4 — CID 55677590
N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide (PubChem CID 55677590) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 55677590 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidine-1-carbonyl)phenyl]-3-(2,5-dioxopyrrolidin-1-yl)benzamide |
| SMILES | CC1CC(C)CN(C(=O)c2ccccc2NC(=O)c2cccc(N3C(=O)CCC3=O)c2)C1 |
| InChI | InChI=1S/C25H27N3O4/c1-16-12-17(2)15-27(14-16)25(32)20-8-3-4-9-21(20)26-24(31)18-6-5-7-19(13-18)28-22(29)10-11-23(28)30/h3-9,13,16-17H,10-12,14-15H2,1-2H3,(H,26,31) |
| InChIKey | ZGBNBASBSYBSIZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|